C23H34O3SSi — CID 139252768
[(1R,4R,5S)-9-(benzenesulfonyl)-4-tricyclo[6.3.0.01,5]undec-8-enyl]oxy-tert-butyl-dimethylsilane (PubChem CID 139252768) has the molecular formula C23H34O3SSi and a molecular weight of 418.68 g/mol. Its IUPAC name is [(1R,4R,5S)-9-(benzenesulfonyl)-4-tricyclo[6.3.0.01,5]undec-8-enyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,4R,5S)-9-(benzenesulfonyl)-4-tricyclo[6.3.0.01,5]undec-8-enyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139252768 |
| Molecular Formula | C23H34O3SSi |
| Molecular Weight | 418.68 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(1R,4R,5S)-9-(benzenesulfonyl)-4-tricyclo[6.3.0.01,5]undec-8-enyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@]23CCC(S(=O)(=O)c4ccccc4)=C2CC[C@H]13 |
| InChI | InChI=1S/C23H34O3SSi/c1-22(2,3)28(4,5)26-20-13-15-23-16-14-21(19(23)12-11-18(20)23)27(24,25)17-9-7-6-8-10-17/h6-10,18,20H,11-16H2,1-5H3/t18-,20-,23-/m1/s1 |
| InChIKey | OQYGCHHGSFUBSI-KKLQWCBXSA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.68 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|