C16H27Cl3O4Si — CID 139252806
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] 2,2,2-trichloroethyl carbonate (PubChem CID 139252806) has the molecular formula C16H27Cl3O4Si and a molecular weight of 417.83 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] 2,2,2-trichloroethyl carbonate.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 139252806 |
| Molecular Formula | C16H27Cl3O4Si |
| Molecular Weight | 417.83 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] 2,2,2-trichloroethyl carbonate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CCCCC1OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H27Cl3O4Si/c1-15(2,3)24(4,5)22-10-12-8-6-7-9-13(12)23-14(20)21-11-16(17,18)19/h8,13H,6-7,9-11H2,1-5H3 |
| InChIKey | DLENXHNOZMUVQH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|