C19H33Cl3O4Si — CID 139252808
2,2,2-trichloroethyl [2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] carbonate (PubChem CID 139252808) has the molecular formula C19H33Cl3O4Si and a molecular weight of 459.91 g/mol. Its IUPAC name is 2,2,2-trichloroethyl [2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] carbonate.
| Compound Name | 2,2,2-trichloroethyl [2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] carbonate |
|---|---|
| PubChem CID | 139252808 |
| Molecular Formula | C19H33Cl3O4Si |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2,2,2-trichloroethyl [2-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl] carbonate |
| SMILES | CC(C)[Si](OCC1=CCCCC1OC(=O)OCC(Cl)(Cl)Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H33Cl3O4Si/c1-13(2)27(14(3)4,15(5)6)25-11-16-9-7-8-10-17(16)26-18(23)24-12-19(20,21)22/h9,13-15,17H,7-8,10-12H2,1-6H3 |
| InChIKey | XSYKYNZHGGQFBJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|