C33H36BF2N3O5 — CID 139252912
[2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)methyl]-3-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-1-yl]-difluoroborane (PubChem CID 139252912) has the molecular formula C33H36BF2N3O5 and a molecular weight of 603.48 g/mol. Its IUPAC name is [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)methyl]-3-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-1-yl]-difluoroborane.
| Compound Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)methyl]-3-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-1-yl]-difluoroborane |
|---|---|
| PubChem CID | 139252912 |
| Molecular Formula | C33H36BF2N3O5 |
| Molecular Weight | 603.48 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl)methyl]-3-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-1-yl]-difluoroborane |
| SMILES | CC1=CC(C)=N/C1=C(/c1ccc2c(c1)OCCOCCOCCOCCO2)c1c(C)cc(/C=C/c2ccncc2)n1B(F)F |
| InChI | InChI=1S/C33H36BF2N3O5/c1-23-20-25(3)38-32(23)31(33-24(2)21-28(39(33)34(35)36)6-4-26-8-10-37-11-9-26)27-5-7-29-30(22-27)44-19-17-42-15-13-40-12-14-41-16-18-43-29/h4-11,20-22H,12-19H2,1-3H3/b6-4+,32-31- |
| InChIKey | BHNZLDTTWOBSGF-YVEJVYGBSA-N |
| XLogP | 6.14 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|