C17H21NO2 — CID 139252968
(4R)-4-(2-methylprop-2-enyl)-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one (PubChem CID 139252968) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (4R)-4-(2-methylprop-2-enyl)-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-(2-methylprop-2-enyl)-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 139252968 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (4R)-4-(2-methylprop-2-enyl)-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
| SMILES | C=C(C)C[C@@]1(CC(C)C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C17H21NO2/c1-12(2)10-17(11-13(3)4)16(19)20-15(18-17)14-8-6-5-7-9-14/h5-9,13H,1,10-11H2,2-4H3/t17-/m0/s1 |
| InChIKey | FXURULUJZREDFC-KRWDZBQOSA-N |
| XLogP | 3.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|