C48H66IrNOP — CID 139253038
(3R)-4'-bis(3,5-ditert-butylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-amine;iridium trihydride;propan-1-ol (PubChem CID 139253038) has the molecular formula C48H66IrNOP and a molecular weight of 896.25 g/mol. Its IUPAC name is (3R)-4'-bis(3,5-ditert-butylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-amine;iridium trihydride;propan-1-ol.
| Compound Name | (3R)-4'-bis(3,5-ditert-butylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-amine;iridium trihydride;propan-1-ol |
|---|---|
| PubChem CID | 139253038 |
| Molecular Formula | C48H66IrNOP |
| Molecular Weight | 896.25 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | (3R)-4'-bis(3,5-ditert-butylphenyl)phosphanyl-3,3'-spirobi[1,2-dihydroindene]-4-amine;iridium trihydride;propan-1-ol |
| SMILES | CC(C)(C)c1cc(P(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cccc3c2[C@]2(CCc4cccc(N)c42)CC3)cc(C(C)(C)C)c1.CCCO.[Ir] |
| InChI | InChI=1S/C45H58NP.C3H8O.Ir/c1-41(2,3)31-23-32(42(4,5)6)26-35(25-31)47(36-27-33(43(7,8)9)24-34(28-36)44(10,11)12)38-18-14-16-30-20-22-45(40(30)38)21-19-29-15-13-17-37(46)39(29)45;1-2-3-4;/h13-18,23-28H,19-22,46H2,1-12H3;4H,2-3H2,1H3;/t45-;;/m1../s1 |
| InChIKey | CVHCJAGNIKGJAA-AOGDZFGQSA-N |
| XLogP | 10.78 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.25 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|