C36H22BF2N3 — CID 139253171
16,16-difluoro-14,18-diphenyl-2,17-diaza-15-azonia-16-boranuidaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(28),2,4(13),5,7,9,11,14,18,20,22,24,26-tridecaene (PubChem CID 139253171) has the molecular formula C36H22BF2N3 and a molecular weight of 545.40 g/mol. Its IUPAC name is 16,16-difluoro-14,18-diphenyl-2,17-diaza-15-azonia-16-boranuidaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(28),2,4(13),5,7,9,11,14,18,20,22,24,26-tridecaene.
| Compound Name | 16,16-difluoro-14,18-diphenyl-2,17-diaza-15-azonia-16-boranuidaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(28),2,4(13),5,7,9,11,14,18,20,22,24,26-tridecaene |
|---|---|
| PubChem CID | 139253171 |
| Molecular Formula | C36H22BF2N3 |
| Molecular Weight | 545.40 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 16,16-difluoro-14,18-diphenyl-2,17-diaza-15-azonia-16-boranuidaheptacyclo[15.11.0.03,15.04,13.05,10.019,28.022,27]octacosa-1(28),2,4(13),5,7,9,11,14,18,20,22,24,26-tridecaene |
| SMILES | F[B-]1(F)n2c(-c3ccccc3)c3ccc4ccccc4c3c2N=C2c3c(ccc4ccccc34)C(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C36H22BF2N3/c38-37(39)41-33(25-13-3-1-4-14-25)29-21-19-23-11-7-9-17-27(23)31(29)35(41)40-36-32-28-18-10-8-12-24(28)20-22-30(32)34(42(36)37)26-15-5-2-6-16-26/h1-22H |
| InChIKey | HMLZUIOGGWOBSA-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.40 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|