C30H23N8Pt+ — CID 139253255
2-phenyl-6-pyridin-2-ylpyridine;2-N-phenyl-6-pyridin-4-yl-1,3,5-triazine-2,4-diamine;platinum(2+) (PubChem CID 139253255) has the molecular formula C30H23N8Pt+ and a molecular weight of 690.65 g/mol. Its IUPAC name is 2-phenyl-6-pyridin-2-ylpyridine;2-N-phenyl-6-pyridin-4-yl-1,3,5-triazine-2,4-diamine;platinum(2+).
| Compound Name | 2-phenyl-6-pyridin-2-ylpyridine;2-N-phenyl-6-pyridin-4-yl-1,3,5-triazine-2,4-diamine;platinum(2+) |
|---|---|
| PubChem CID | 139253255 |
| Molecular Formula | C30H23N8Pt+ |
| Molecular Weight | 690.65 g/mol |
| Exact Mass | 690.17 |
| IUPAC Name | 2-phenyl-6-pyridin-2-ylpyridine;2-N-phenyl-6-pyridin-4-yl-1,3,5-triazine-2,4-diamine;platinum(2+) |
| SMILES | Nc1nc(Nc2ccccc2)nc(-c2ccncc2)n1.[Pt+2].[c-]1ccccc1-c1cccc(-c2ccccn2)n1 |
| InChI | InChI=1S/C16H11N2.C14H12N6.Pt/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15;15-13-18-12(10-6-8-16-9-7-10)19-14(20-13)17-11-4-2-1-3-5-11;/h1-7,9-12H;1-9H,(H3,15,17,18,19,20);/q-1;;+2 |
| InChIKey | CZZIFUOWWUIDTA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 115.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|