C7H9N3O5 — CID 139253334
(2R)-N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,3-dihydroxypropanamide (PubChem CID 139253334) has the molecular formula C7H9N3O5 and a molecular weight of 215.16 g/mol. Its IUPAC name is (2R)-N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,3-dihydroxypropanamide.
| Compound Name | (2R)-N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 139253334 |
| Molecular Formula | C7H9N3O5 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | (2R)-N-(2,4-dioxo-1H-pyrimidin-5-yl)-2,3-dihydroxypropanamide |
| SMILES | O=C(Nc1c[nH]c(=O)[nH]c1=O)[C@H](O)CO |
| InChI | InChI=1S/C7H9N3O5/c11-2-4(12)6(14)9-3-1-8-7(15)10-5(3)13/h1,4,11-12H,2H2,(H,9,14)(H2,8,10,13,15)/t4-/m1/s1 |
| InChIKey | BZATZPZGYUCXNC-SCSAIBSYSA-N |
| XLogP | -2.65 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |