About N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide
N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide (PubChem CID 139253362) has the molecular formula C21H27F2NO2Si
and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide |
| PubChem CID | 139253362 |
| Molecular Formula | C21H27F2NO2Si |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC(CNC(=O)c1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C21H27F2NO2Si/c1-21(2,3)27(4,5)26-18(15-10-7-6-8-11-15)14-24-20(25)19-16(22)12-9-13-17(19)23/h6-13,18H,14H2,1-5H3,(H,24,25) |
| InChIKey | JSTHAAWHGXTIBI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide?
The IUPAC name of N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide (CID 139253362) is N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide is CC(C)(C)[Si](C)(C)OC(CNC(=O)c1c(F)cccc1F)c1ccccc1.
What is the InChIKey of N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide?
The InChIKey is JSTHAAWHGXTIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27F2NO2Si/c1-21(2,3)27(4,5)26-18(15-10-7-6-8-11-15)14-24-20(25)19-16(22)12-9-13-17(19)23/h6-13,18H,14H2,1-5H3,(H,24,25).
What are the key properties of N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide?
N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide has a molecular weight of 391.53 g/mol, XLogP of 5.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl]-2,6-difluorobenzamide is sourced from PubChem (CID 139253362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).