C31H30N6O5 — CID 139253477
methyl 2-[4-methoxy-4-(4-nitrophenyl)-5H-imidazo[1,2-a]quinoxalin-7-yl]-1-(3-methylbutyl)benzimidazole-5-carboxylate (PubChem CID 139253477) has the molecular formula C31H30N6O5 and a molecular weight of 566.62 g/mol. Its IUPAC name is methyl 2-[4-methoxy-4-(4-nitrophenyl)-5H-imidazo[1,2-a]quinoxalin-7-yl]-1-(3-methylbutyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[4-methoxy-4-(4-nitrophenyl)-5H-imidazo[1,2-a]quinoxalin-7-yl]-1-(3-methylbutyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 139253477 |
| Molecular Formula | C31H30N6O5 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | methyl 2-[4-methoxy-4-(4-nitrophenyl)-5H-imidazo[1,2-a]quinoxalin-7-yl]-1-(3-methylbutyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1ccc3c(c1)NC(OC)(c1ccc([N+](=O)[O-])cc1)c1nccn1-3)n2CCC(C)C |
| InChI | InChI=1S/C31H30N6O5/c1-19(2)13-15-35-26-12-6-21(29(38)41-3)18-24(26)33-28(35)20-5-11-27-25(17-20)34-31(42-4,30-32-14-16-36(27)30)22-7-9-23(10-8-22)37(39)40/h5-12,14,16-19,34H,13,15H2,1-4H3 |
| InChIKey | QSXLCQDZNUUMCE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|