C20H20BClF2N2OS — CID 139253512
5-chloro-2,2-difluoro-4,6,10,12-tetramethyl-11-methylsulfinyl-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139253512) has the molecular formula C20H20BClF2N2OS and a molecular weight of 420.72 g/mol. Its IUPAC name is 5-chloro-2,2-difluoro-4,6,10,12-tetramethyl-11-methylsulfinyl-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 5-chloro-2,2-difluoro-4,6,10,12-tetramethyl-11-methylsulfinyl-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139253512 |
| Molecular Formula | C20H20BClF2N2OS |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 5-chloro-2,2-difluoro-4,6,10,12-tetramethyl-11-methylsulfinyl-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(S(C)=O)C(C)=[N+]2C1=C(c1ccccc1)c1c(C)c(Cl)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C20H20BClF2N2OS/c1-11-17(22)13(3)25-18(11)16(15-9-7-6-8-10-15)19-12(2)20(28(5)27)14(4)26(19)21(25,23)24/h6-10H,1-5H3 |
| InChIKey | KDDBHRQNSYXEEC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 25.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|