C26H28F3NO4 — CID 139253561
[(9aR)-9a-benzyl-5-oxo-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139253561) has the molecular formula C26H28F3NO4 and a molecular weight of 475.51 g/mol. Its IUPAC name is [(9aR)-9a-benzyl-5-oxo-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(9aR)-9a-benzyl-5-oxo-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139253561 |
| Molecular Formula | C26H28F3NO4 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [(9aR)-9a-benzyl-5-oxo-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-9-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)OC1CCCC(=O)N2CCC[C@@]12Cc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C26H28F3NO4/c1-33-25(26(27,28)29,20-12-6-3-7-13-20)23(32)34-21-14-8-15-22(31)30-17-9-16-24(21,30)18-19-10-4-2-5-11-19/h2-7,10-13,21H,8-9,14-18H2,1H3/t21?,24-,25-/m1/s1 |
| InChIKey | YSZDTKGDTPNRET-LYWQJQBASA-N |
| XLogP | 4.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |