C30H34N2O7 — CID 139254341
diethyl (1R,9S,11R)-10,10-dimethyl-15-[(1S)-1-(4-nitrophenyl)ethyl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate (PubChem CID 139254341) has the molecular formula C30H34N2O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is diethyl (1R,9S,11R)-10,10-dimethyl-15-[(1S)-1-(4-nitrophenyl)ethyl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate.
| Compound Name | diethyl (1R,9S,11R)-10,10-dimethyl-15-[(1S)-1-(4-nitrophenyl)ethyl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate |
|---|---|
| PubChem CID | 139254341 |
| Molecular Formula | C30H34N2O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | diethyl (1R,9S,11R)-10,10-dimethyl-15-[(1S)-1-(4-nitrophenyl)ethyl]-2-oxo-15-azatetracyclo[7.5.1.01,11.03,8]pentadeca-3,5,7-triene-13,13-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2C(C)(C)[C@H]3c4ccccc4C(=O)[C@]2(C1)N3[C@@H](C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H34N2O7/c1-6-38-26(34)29(27(35)39-7-2)16-23-28(4,5)24-21-10-8-9-11-22(21)25(33)30(23,17-29)31(24)18(3)19-12-14-20(15-13-19)32(36)37/h8-15,18,23-24H,6-7,16-17H2,1-5H3/t18-,23+,24+,30+/m0/s1 |
| InChIKey | IEADZFOBPFMIHX-STUAPGLFSA-N |
| XLogP | 5.20 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|