C17H28O3 — CID 139254445
methyl (3aS,3bS,4R,5R,6aR,7R,7aS)-3b-hydroxy-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalene-5-carboxylate (PubChem CID 139254445) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is methyl (3aS,3bS,4R,5R,6aR,7R,7aS)-3b-hydroxy-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalene-5-carboxylate.
| Compound Name | methyl (3aS,3bS,4R,5R,6aR,7R,7aS)-3b-hydroxy-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalene-5-carboxylate |
|---|---|
| PubChem CID | 139254445 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | methyl (3aS,3bS,4R,5R,6aR,7R,7aS)-3b-hydroxy-3,3,4,7-tetramethyl-2,3a,4,5,6,6a,7,7a-octahydro-1H-cyclopenta[a]pentalene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2[C@H](C)[C@@H]3CCC(C)(C)[C@H]3[C@]2(O)[C@@H]1C |
| InChI | InChI=1S/C17H28O3/c1-9-11-6-7-16(3,4)14(11)17(19)10(2)12(8-13(9)17)15(18)20-5/h9-14,19H,6-8H2,1-5H3/t9-,10-,11+,12-,13-,14+,17+/m1/s1 |
| InChIKey | XPVAEVZPZCIDEM-XDKFKZBESA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |