C21H20O3 — CID 139254493
(6aR)-4-[4-[(3aR)-2-oxo-3a,4,5,6-tetrahydro-3H-pentalen-1-yl]phenyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 139254493) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (6aR)-4-[4-[(3aR)-2-oxo-3a,4,5,6-tetrahydro-3H-pentalen-1-yl]phenyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (6aR)-4-[4-[(3aR)-2-oxo-3a,4,5,6-tetrahydro-3H-pentalen-1-yl]phenyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 139254493 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (6aR)-4-[4-[(3aR)-2-oxo-3a,4,5,6-tetrahydro-3H-pentalen-1-yl]phenyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | O=C1C[C@H]2CCCC2=C1c1ccc(C2=C3COC[C@@H]3CC2=O)cc1 |
| InChI | InChI=1S/C21H20O3/c22-18-8-14-2-1-3-16(14)20(18)12-4-6-13(7-5-12)21-17-11-24-10-15(17)9-19(21)23/h4-7,14-15H,1-3,8-11H2/t14-,15+/m1/s1 |
| InChIKey | XHEBKAJEZXBIMA-CABCVRRESA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |