C8H10O2 — CID 139254710
3-buta-2,3-dien-2-yloxolan-2-one (PubChem CID 139254710) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-buta-2,3-dien-2-yloxolan-2-one.
| Compound Name | 3-buta-2,3-dien-2-yloxolan-2-one |
|---|---|
| PubChem CID | 139254710 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 3-buta-2,3-dien-2-yloxolan-2-one |
| SMILES | C=C=C(C)C1CCOC1=O |
| InChI | InChI=1S/C8H10O2/c1-3-6(2)7-4-5-10-8(7)9/h7H,1,4-5H2,2H3 |
| InChIKey | RAGFWSQMYKRWGN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |