C12H22N+ — CID 139254730
1,1,3,4-tetramethyl-6-propan-2-ylidene-2,5-dihydropyridin-1-ium (PubChem CID 139254730) has the molecular formula C12H22N+ and a molecular weight of 180.31 g/mol. Its IUPAC name is 1,1,3,4-tetramethyl-6-propan-2-ylidene-2,5-dihydropyridin-1-ium.
| Compound Name | 1,1,3,4-tetramethyl-6-propan-2-ylidene-2,5-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 139254730 |
| Molecular Formula | C12H22N+ |
| Molecular Weight | 180.31 g/mol |
| Exact Mass | 180.17 |
| IUPAC Name | 1,1,3,4-tetramethyl-6-propan-2-ylidene-2,5-dihydropyridin-1-ium |
| SMILES | CC(C)=C1CC(C)=C(C)C[N+]1(C)C |
| InChI | InChI=1S/C12H22N/c1-9(2)12-7-10(3)11(4)8-13(12,5)6/h7-8H2,1-6H3/q+1 |
| InChIKey | BYXJKTWJHGVWSP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|