About (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one
(3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one (PubChem CID 139254943) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one |
| PubChem CID | 139254943 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one |
| SMILES | CC(C)=C[C@@H]1C(=O)Oc2c(C)cccc2[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C15H17NO4/c1-9(2)7-12-13(8-16(18)19)11-6-4-5-10(3)14(11)20-15(12)17/h4-7,12-13H,8H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | OEKUTNCUAQOOKD-STQMWFEESA-N |
| XLogP | 2.86 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one?
The IUPAC name of (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one (CID 139254943) is (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one.
What is the SMILES notation for (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one?
The canonical SMILES for (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one is CC(C)=C[C@@H]1C(=O)Oc2c(C)cccc2[C@@H]1C[N+](=O)[O-].
What is the InChIKey of (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one?
The InChIKey is OEKUTNCUAQOOKD-STQMWFEESA-N. The full InChI is InChI=1S/C15H17NO4/c1-9(2)7-12-13(8-16(18)19)11-6-4-5-10(3)14(11)20-15(12)17/h4-7,12-13H,8H2,1-3H3/t12-,13-/m0/s1.
What are the key properties of (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one?
(3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one has a molecular weight of 275.30 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-8-methyl-3-(2-methylprop-1-enyl)-4-(nitromethyl)-3,4-dihydrochromen-2-one is sourced from PubChem (CID 139254943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).