About (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione
(1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione (PubChem CID 139254970) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione.
Molecular Properties
| Compound Name | (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione |
| PubChem CID | 139254970 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione |
| SMILES | O=C1CCC[C@@]2(CC3(CCCCCC3)CC2=O)[C@@H]1O |
| InChI | InChI=1S/C16H24O3/c17-12-6-5-9-16(14(12)19)11-15(10-13(16)18)7-3-1-2-4-8-15/h14,19H,1-11H2/t14-,16+/m1/s1 |
| InChIKey | UPSHRFKKMIHKBI-ZBFHGGJFSA-N |
| XLogP | 2.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione?
The IUPAC name of (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione (CID 139254970) is (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione.
What is the SMILES notation for (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione?
The canonical SMILES for (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione is O=C1CCC[C@@]2(CC3(CCCCCC3)CC2=O)[C@@H]1O.
What is the InChIKey of (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione?
The InChIKey is UPSHRFKKMIHKBI-ZBFHGGJFSA-N. The full InChI is InChI=1S/C16H24O3/c17-12-6-5-9-16(14(12)19)11-15(10-13(16)18)7-3-1-2-4-8-15/h14,19H,1-11H2/t14-,16+/m1/s1.
What are the key properties of (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione?
(1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione has a molecular weight of 264.36 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-1-hydroxydispiro[5.1.68.26]hexadecane-2,16-dione is sourced from PubChem (CID 139254970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).