C27H52O3Si2 — CID 139254987
tert-butyl-dimethyl-[[(1R,2S,6R,9R,10S)-9-methyl-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-2-yl]oxy]silane (PubChem CID 139254987) has the molecular formula C27H52O3Si2 and a molecular weight of 480.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2S,6R,9R,10S)-9-methyl-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-2-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2S,6R,9R,10S)-9-methyl-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-2-yl]oxy]silane |
|---|---|
| PubChem CID | 139254987 |
| Molecular Formula | C27H52O3Si2 |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2S,6R,9R,10S)-9-methyl-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-2-yl]oxy]silane |
| SMILES | CC(C)[Si](O[C@H]1C[C@@]23O[C@]1(C)C=C[C@H]2CCC[C@@H]3O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O3Si2/c1-19(2)32(20(3)4,21(5)6)29-24-18-27-22(16-17-26(24,10)30-27)14-13-15-23(27)28-31(11,12)25(7,8)9/h16-17,19-24H,13-15,18H2,1-12H3/t22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | NMVZCVHMGXFMNT-IWRPRKENSA-N |
| XLogP | 8.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|