C27H52O3Si2 — CID 139254991
tert-butyl-dimethyl-[[(1S,9S,10R)-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-9-yl]methoxy]silane (PubChem CID 139254991) has the molecular formula C27H52O3Si2 and a molecular weight of 480.88 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,9S,10R)-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-9-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,9S,10R)-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-9-yl]methoxy]silane |
|---|---|
| PubChem CID | 139254991 |
| Molecular Formula | C27H52O3Si2 |
| Molecular Weight | 480.88 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,9S,10R)-10-tri(propan-2-yl)silyloxy-12-oxatricyclo[7.2.1.01,6]dodec-7-en-9-yl]methoxy]silane |
| SMILES | CC(C)[Si](O[C@@H]1C[C@@]23CCCCC2C=C[C@@]1(CO[Si](C)(C)C(C)(C)C)O3)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O3Si2/c1-20(2)32(21(3)4,22(5)6)29-24-18-26-16-13-12-14-23(26)15-17-27(24,30-26)19-28-31(10,11)25(7,8)9/h15,17,20-24H,12-14,16,18-19H2,1-11H3/t23?,24-,26+,27+/m1/s1 |
| InChIKey | AYQMUYUZPNIPRO-SDAXYKDKSA-N |
| XLogP | 8.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.88 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|