About 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene
2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene (PubChem CID 139255062) has the molecular formula C29H28O2S2
and a molecular weight of 472.68 g/mol. Its IUPAC name is 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene.
Molecular Properties
| Compound Name | 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene |
| PubChem CID | 139255062 |
| Molecular Formula | C29H28O2S2 |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene |
| SMILES | C=CCCOc1cccc(OCCC=C)c1-c1ccsc1-c1sccc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C29H28O2S2/c1-4-6-17-30-25-9-8-10-26(31-18-7-5-2)27(25)24-16-20-33-29(24)28-23(15-19-32-28)22-13-11-21(3)12-14-22/h4-5,8-16,19-20H,1-2,6-7,17-18H2,3H3 |
| InChIKey | MYGKLQUVSVQFEP-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene?
The IUPAC name of 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene (CID 139255062) is 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene.
What is the SMILES notation for 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene?
The canonical SMILES for 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene is C=CCCOc1cccc(OCCC=C)c1-c1ccsc1-c1sccc1-c1ccc(C)cc1.
What is the InChIKey of 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene?
The InChIKey is MYGKLQUVSVQFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28O2S2/c1-4-6-17-30-25-9-8-10-26(31-18-7-5-2)27(25)24-16-20-33-29(24)28-23(15-19-32-28)22-13-11-21(3)12-14-22/h4-5,8-16,19-20H,1-2,6-7,17-18H2,3H3.
What are the key properties of 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene?
2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene has a molecular weight of 472.68 g/mol, XLogP of 9.03, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2,6-bis(but-3-enoxy)phenyl]thiophen-2-yl]-3-(4-methylphenyl)thiophene is sourced from PubChem (CID 139255062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).