C22H36O6Si — CID 139255190
(1R,2R,5R,6R,7R,8R)-8-ethoxycarbonyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-10-carboxylic acid (PubChem CID 139255190) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (1R,2R,5R,6R,7R,8R)-8-ethoxycarbonyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-10-carboxylic acid.
| Compound Name | (1R,2R,5R,6R,7R,8R)-8-ethoxycarbonyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 139255190 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (1R,2R,5R,6R,7R,8R)-8-ethoxycarbonyl-1,5-dimethyl-7-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-9-ene-10-carboxylic acid |
| SMILES | CCOC(=O)[C@]12C=C(C(=O)O)[C@](C)(O1)[C@@H]1CC[C@@H](C)[C@H]1[C@H]2O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H36O6Si/c1-7-26-20(25)22-13-16(19(23)24)21(6,28-22)15-12-11-14(5)17(15)18(22)27-29(8-2,9-3)10-4/h13-15,17-18H,7-12H2,1-6H3,(H,23,24)/t14-,15-,17-,18-,21-,22-/m1/s1 |
| InChIKey | BIRHHINFLIOSSM-HLEMCZNHSA-N |
| XLogP | 4.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|