C20H34O4 — CID 139255199
[(1R,3aR,4R,7S,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-8-oxo-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate (PubChem CID 139255199) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(1R,3aR,4R,7S,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-8-oxo-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,3aR,4R,7S,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-8-oxo-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139255199 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(1R,3aR,4R,7S,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-8-oxo-1,2,3,3a,5,6,7,8a-octahydroazulen-4-yl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]1C(=O)[C@H](C(C)(C)O)CC[C@@]2(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H34O4/c1-12-8-9-13-15(12)16(21)14(19(5,6)23)10-11-20(13,7)24-17(22)18(2,3)4/h12-15,23H,8-11H2,1-7H3/t12-,13-,14-,15+,20-/m1/s1 |
| InChIKey | JFJYBSJISIXDOM-BATKGTNTSA-N |
| XLogP | 3.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |