C29H36O6Si — CID 139255284
(1S,2R,5S,6R,9S,10R,12R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-hydroxy-5,12-dimethyl-3,7-dioxatricyclo[7.3.0.02,6]dodecane-4,11-dione (PubChem CID 139255284) has the molecular formula C29H36O6Si and a molecular weight of 508.69 g/mol. Its IUPAC name is (1S,2R,5S,6R,9S,10R,12R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-hydroxy-5,12-dimethyl-3,7-dioxatricyclo[7.3.0.02,6]dodecane-4,11-dione.
| Compound Name | (1S,2R,5S,6R,9S,10R,12R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-hydroxy-5,12-dimethyl-3,7-dioxatricyclo[7.3.0.02,6]dodecane-4,11-dione |
|---|---|
| PubChem CID | 139255284 |
| Molecular Formula | C29H36O6Si |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (1S,2R,5S,6R,9S,10R,12R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-hydroxy-5,12-dimethyl-3,7-dioxatricyclo[7.3.0.02,6]dodecane-4,11-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@@H]1OC[C@H]1[C@@H]2[C@@](C)(O)C(=O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H36O6Si/c1-18-24-25(35-27(18)31)23-21(16-33-24)22(26(30)29(23,5)32)17-34-36(28(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,18,21-25,32H,16-17H2,1-5H3/t18-,21+,22-,23-,24+,25+,29+/m0/s1 |
| InChIKey | KIKFACUCOXAKDA-BJENYARDSA-N |
| XLogP | 2.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|