C28H34O4Si — CID 139255291
(2R,6R,9R,10R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methyl-3,7-dioxatricyclo[7.3.0.02,6]dodec-11-en-4-one (PubChem CID 139255291) has the molecular formula C28H34O4Si and a molecular weight of 462.66 g/mol. Its IUPAC name is (2R,6R,9R,10R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methyl-3,7-dioxatricyclo[7.3.0.02,6]dodec-11-en-4-one.
| Compound Name | (2R,6R,9R,10R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methyl-3,7-dioxatricyclo[7.3.0.02,6]dodec-11-en-4-one |
|---|---|
| PubChem CID | 139255291 |
| Molecular Formula | C28H34O4Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (2R,6R,9R,10R)-10-[[tert-butyl(diphenyl)silyl]oxymethyl]-12-methyl-3,7-dioxatricyclo[7.3.0.02,6]dodec-11-en-4-one |
| SMILES | CC1=C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2CO[C@@H]3CC(=O)O[C@@H]3C12 |
| InChI | InChI=1S/C28H34O4Si/c1-19-15-20(23-18-30-24-16-25(29)32-27(24)26(19)23)17-31-33(28(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-15,20,23-24,26-27H,16-18H2,1-4H3/t20-,23+,24+,26?,27-/m0/s1 |
| InChIKey | WOHANIFYVZEQDV-HGURSNDISA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|