C30H57N7O9 — CID 139255376
tert-butyl N-[(2S)-1-[2-[bis[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 139255376) has the molecular formula C30H57N7O9 and a molecular weight of 659.83 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-[bis[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-[bis[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139255376 |
| Molecular Formula | C30H57N7O9 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.42 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-[bis[2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)NCCN(CCNC(=O)[C@H](C)NC(=O)OC(C)(C)C)CCNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H57N7O9/c1-19(34-25(41)44-28(4,5)6)22(38)31-13-16-37(17-14-32-23(39)20(2)35-26(42)45-29(7,8)9)18-15-33-24(40)21(3)36-27(43)46-30(10,11)12/h19-21H,13-18H2,1-12H3,(H,31,38)(H,32,39)(H,33,40)(H,34,41)(H,35,42)(H,36,43)/t19-,20-,21-/m0/s1 |
| InChIKey | HHAVDTHHEHNXOY-ACRUOGEOSA-N |
| XLogP | 1.38 |
| TPSA | 205.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|