C13H18INO2 — CID 139255454
(1R,5S)-3-ethyl-8-(4-iodobutanoyl)-8-azabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 139255454) has the molecular formula C13H18INO2 and a molecular weight of 347.20 g/mol. Its IUPAC name is (1R,5S)-3-ethyl-8-(4-iodobutanoyl)-8-azabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5S)-3-ethyl-8-(4-iodobutanoyl)-8-azabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 139255454 |
| Molecular Formula | C13H18INO2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (1R,5S)-3-ethyl-8-(4-iodobutanoyl)-8-azabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CCC1=C[C@@H]2CC[C@H](C1=O)N2C(=O)CCCI |
| InChI | InChI=1S/C13H18INO2/c1-2-9-8-10-5-6-11(13(9)17)15(10)12(16)4-3-7-14/h8,10-11H,2-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | YIWYYQRQOPEOMV-WDEREUQCSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|