C21H23Cl3N2O8 — CID 139255487
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(benzylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 139255487) has the molecular formula C21H23Cl3N2O8 and a molecular weight of 537.78 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(benzylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(benzylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139255487 |
| Molecular Formula | C21H23Cl3N2O8 |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-(benzylideneamino)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1/N=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H23Cl3N2O8/c1-11(27)30-10-15-17(31-12(2)28)18(32-13(3)29)16(26-9-14-7-5-4-6-8-14)19(33-15)34-20(25)21(22,23)24/h4-9,15-19,25H,10H2,1-3H3/b25-20+,26-9+/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | HCANBTBXLHEOTG-OVWBSUBLSA-N |
| XLogP | 2.99 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|