C21H22Cl3FN2O8 — CID 139255488
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(4-fluorophenyl)methylideneamino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 139255488) has the molecular formula C21H22Cl3FN2O8 and a molecular weight of 555.77 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(4-fluorophenyl)methylideneamino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(4-fluorophenyl)methylideneamino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139255488 |
| Molecular Formula | C21H22Cl3FN2O8 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-5-[(4-fluorophenyl)methylideneamino]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1/N=C/c1ccc(F)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H22Cl3FN2O8/c1-10(28)31-9-15-17(32-11(2)29)18(33-12(3)30)16(19(34-15)35-20(26)21(22,23)24)27-8-13-4-6-14(25)7-5-13/h4-8,15-19,26H,9H2,1-3H3/b26-20+,27-8+/t15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | AWYPTYLTIAMFKQ-JPWUUIOCSA-N |
| XLogP | 3.13 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|