C32H37NO7 — CID 139255587
1-O-benzyl 2-O-tert-butyl (2R,3R,4S,5S)-3-hydroxy-4,5-bis(phenylmethoxy)piperidine-1,2-dicarboxylate (PubChem CID 139255587) has the molecular formula C32H37NO7 and a molecular weight of 547.65 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl (2R,3R,4S,5S)-3-hydroxy-4,5-bis(phenylmethoxy)piperidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl (2R,3R,4S,5S)-3-hydroxy-4,5-bis(phenylmethoxy)piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139255587 |
| Molecular Formula | C32H37NO7 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl (2R,3R,4S,5S)-3-hydroxy-4,5-bis(phenylmethoxy)piperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@@H](O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H37NO7/c1-32(2,3)40-30(35)27-28(34)29(38-21-24-15-9-5-10-16-24)26(37-20-23-13-7-4-8-14-23)19-33(27)31(36)39-22-25-17-11-6-12-18-25/h4-18,26-29,34H,19-22H2,1-3H3/t26-,27+,28+,29+/m0/s1 |
| InChIKey | WEXNBHNBMDKWTB-AMSOURPBSA-N |
| XLogP | 4.88 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |