C4H6F4N10O2 — CID 139255627
[4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide;diaminomethylideneazanium (PubChem CID 139255627) has the molecular formula C4H6F4N10O2 and a molecular weight of 302.15 g/mol. Its IUPAC name is [4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide;diaminomethylideneazanium.
| Compound Name | [4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide;diaminomethylideneazanium |
|---|---|
| PubChem CID | 139255627 |
| Molecular Formula | C4H6F4N10O2 |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [4,6-bis(difluoroamino)-1,3,5-triazin-2-yl]-nitroazanide;diaminomethylideneazanium |
| SMILES | NC(N)=[NH2+].O=[N+]([O-])[N-]c1nc(N(F)F)nc(N(F)F)n1 |
| InChI | InChI=1S/C3F4N7O2.CH5N3/c4-12(5)2-8-1(11-14(15)16)9-3(10-2)13(6)7;2-1(3)4/h;(H5,2,3,4)/q-1;/p+1 |
| InChIKey | HNFFYUFLFXPAPM-UHFFFAOYSA-O |
| XLogP | -1.76 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|