C3H4N7O2- — CID 139255632
(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255632) has the molecular formula C3H4N7O2- and a molecular weight of 170.11 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255632 |
| Molecular Formula | C3H4N7O2- |
| Molecular Weight | 170.11 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | Nc1nc(N)nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H4N7O2/c4-1-6-2(5)8-3(7-1)9-10(11)12/h(H4-,4,5,6,7,8,9)/q-1 |
| InChIKey | UIZTWKLBPAGTCY-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.11 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|