C4H7N11O6 — CID 139255634
amino(diaminomethylidene)azanium;(4,6-dinitro-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255634) has the molecular formula C4H7N11O6 and a molecular weight of 305.17 g/mol. Its IUPAC name is amino(diaminomethylidene)azanium;(4,6-dinitro-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | amino(diaminomethylidene)azanium;(4,6-dinitro-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255634 |
| Molecular Formula | C4H7N11O6 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | amino(diaminomethylidene)azanium;(4,6-dinitro-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | N[NH+]=C(N)N.O=[N+]([O-])[N-]c1nc([N+](=O)[O-])nc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C3N7O6.CH6N4/c11-8(12)2-4-1(7-10(15)16)5-3(6-2)9(13)14;2-1(3)5-4/h;4H2,(H4,2,3,5)/q-1;/p+1 |
| InChIKey | XLIMPQMBWNZKER-UHFFFAOYSA-O |
| XLogP | -3.90 |
| TPSA | 274.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|