C4H7N11O8 — CID 139255636
amino(diaminomethylidene)azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255636) has the molecular formula C4H7N11O8 and a molecular weight of 337.17 g/mol. Its IUPAC name is amino(diaminomethylidene)azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | amino(diaminomethylidene)azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255636 |
| Molecular Formula | C4H7N11O8 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | amino(diaminomethylidene)azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | N[NH+]=C(N)N.O=[N+]([O-])[N-]c1nc(O[N+](=O)[O-])nc(O[N+](=O)[O-])n1 |
| InChI | InChI=1S/C3N7O8.CH6N4/c11-8(12)7-1-4-2(17-9(13)14)6-3(5-1)18-10(15)16;2-1(3)5-4/h;4H2,(H4,2,3,5)/q-1;/p+1 |
| InChIKey | CPZFPFZGYMAZBD-UHFFFAOYSA-O |
| XLogP | -4.58 |
| TPSA | 292.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|