C4H8N16O2 — CID 139255638
(Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255638) has the molecular formula C4H8N16O2 and a molecular weight of 312.22 g/mol. Its IUPAC name is (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255638 |
| Molecular Formula | C4H8N16O2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diazido-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NN/C(N)=[NH+]\N.[N-]=[N+]=Nc1nc(N=[N+]=[N-])nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3N11O2.CH7N5/c4-12-9-1-6-2(10-13-5)8-3(7-1)11-14(15)16;2-1(5-3)6-4/h;3-4H2,(H3,2,5,6)/q-1;/p+1 |
| InChIKey | PCAYDPPCRGBHTB-UHFFFAOYSA-O |
| XLogP | -2.33 |
| TPSA | 297.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|