C4H12N12O2 — CID 139255642
(Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255642) has the molecular formula C4H12N12O2 and a molecular weight of 260.22 g/mol. Its IUPAC name is (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255642 |
| Molecular Formula | C4H12N12O2 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (Z)-amino-[amino(hydrazinyl)methylidene]azanium;(4,6-diamino-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NN/C(N)=[NH+]\N.Nc1nc(N)nc([N-][N+](=O)[O-])n1 |
| InChI | InChI=1S/C3H4N7O2.CH7N5/c4-1-6-2(5)8-3(7-1)9-10(11)12;2-1(5-3)6-4/h(H4-,4,5,6,7,8,9);3-4H2,(H3,2,5,6)/q-1;/p+1 |
| InChIKey | RNBSFWVNVXYEQW-UHFFFAOYSA-O |
| XLogP | -5.05 |
| TPSA | 252.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -5.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|