C5H7N11O9 — CID 139255651
[amino-(carbamoylamino)methylidene]azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide (PubChem CID 139255651) has the molecular formula C5H7N11O9 and a molecular weight of 365.18 g/mol. Its IUPAC name is [amino-(carbamoylamino)methylidene]azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide.
| Compound Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide |
|---|---|
| PubChem CID | 139255651 |
| Molecular Formula | C5H7N11O9 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | [amino-(carbamoylamino)methylidene]azanium;(4,6-dinitrooxy-1,3,5-triazin-2-yl)-nitroazanide |
| SMILES | NC(=[NH2+])NC(N)=O.O=[N+]([O-])[N-]c1nc(O[N+](=O)[O-])nc(O[N+](=O)[O-])n1 |
| InChI | InChI=1S/C3N7O8.C2H6N4O/c11-8(12)7-1-4-2(17-9(13)14)6-3(5-1)18-10(15)16;3-1(4)6-2(5)7/h;(H6,3,4,5,6,7)/q-1;/p+1 |
| InChIKey | QKANGQPBENLPEA-UHFFFAOYSA-O |
| XLogP | -4.06 |
| TPSA | 307.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|