About CID 139255724
CID 139255724 (PubChem CID 139255724) has the molecular formula C56H52FeN5O13
and a molecular weight of 1058.90 g/mol.
Molecular Properties
| Compound Name | CID 139255724 |
| PubChem CID | 139255724 |
| Molecular Formula | C56H52FeN5O13 |
| Molecular Weight | 1058.90 g/mol |
| Exact Mass | 1058.29 |
| IUPAC Name | — |
| SMILES | COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5cc(OC)c(OC)c(OC)c5)c5ccc2[n-]5)C=C4)C=C3)cc(OC)c1OC.[Fe+2].[N]=O |
| InChI | InChI=1S/C56H52N4O12.Fe.NO/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6;;1-2/h13-28H,1-12H3;;/q-2;+2;/b49-33-,49-34-,50-35-,50-37-,51-36-,51-38-,52-39-,52-40-;; |
| InChIKey | CMHAXSFLXPAWFJ-FROCSNILSA-N |
| XLogP | 10.24 |
| TPSA | 204.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1058.90 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139255724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139255724?
The IUPAC name of CID 139255724 (CID 139255724) is not available.
What is the SMILES notation for CID 139255724?
The canonical SMILES for CID 139255724 is COc1cc(-c2c3nc(c(-c4cc(OC)c(OC)c(OC)c4)c4ccc([n-]4)c(-c4cc(OC)c(OC)c(OC)c4)c4nc(c(-c5cc(OC)c(OC)c(OC)c5)c5ccc2[n-]5)C=C4)C=C3)cc(OC)c1OC.[Fe+2].[N]=O.
What is the InChIKey of CID 139255724?
The InChIKey is CMHAXSFLXPAWFJ-FROCSNILSA-N. The full InChI is InChI=1S/C56H52N4O12.Fe.NO/c1-61-41-21-29(22-42(62-2)53(41)69-9)49-33-13-15-35(57-33)50(30-23-43(63-3)54(70-10)44(24-30)64-4)37-17-19-39(59-37)52(32-27-47(67-7)56(72-12)48(28-32)68-8)40-20-18-38(60-40)51(36-16-14-34(49)58-36)31-25-45(65-5)55(71-11)46(26-31)66-6;;1-2/h13-28H,1-12H3;;/q-2;+2;/b49-33-,49-34-,50-35-,50-37-,51-36-,51-38-,52-39-,52-40-;;.
What are the key properties of CID 139255724?
CID 139255724 has a molecular weight of 1058.90 g/mol, XLogP of 10.24, 16 rotatable bonds, 0 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139255724 is sourced from PubChem (CID 139255724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).