C28H30N2S2 — CID 139255778
trans-(1S,2S)-1-N,2-N-bis[(4-phenylthiophen-2-yl)methyl]cyclohexane-1,2-diamine (PubChem CID 139255778) has the molecular formula C28H30N2S2 and a molecular weight of 458.70 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis[(4-phenylthiophen-2-yl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis[(4-phenylthiophen-2-yl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 139255778 |
| Molecular Formula | C28H30N2S2 |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis[(4-phenylthiophen-2-yl)methyl]cyclohexane-1,2-diamine |
| SMILES | c1ccc(-c2csc(CN[C@H]3CCCC[C@@H]3NCc3cc(-c4ccccc4)cs3)c2)cc1 |
| InChI | InChI=1S/C28H30N2S2/c1-3-9-21(10-4-1)23-15-25(31-19-23)17-29-27-13-7-8-14-28(27)30-18-26-16-24(20-32-26)22-11-5-2-6-12-22/h1-6,9-12,15-16,19-20,27-30H,7-8,13-14,17-18H2/t27-,28-/m0/s1 |
| InChIKey | MZZFMIMRQQFPRI-NSOVKSMOSA-N |
| XLogP | 7.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.70 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |