C23H39NO3Si — CID 139255785
(3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,4-dimethyl-3-(2-prop-1-en-2-ylphenyl)pentanamide (PubChem CID 139255785) has the molecular formula C23H39NO3Si and a molecular weight of 405.66 g/mol. Its IUPAC name is (3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,4-dimethyl-3-(2-prop-1-en-2-ylphenyl)pentanamide.
| Compound Name | (3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,4-dimethyl-3-(2-prop-1-en-2-ylphenyl)pentanamide |
|---|---|
| PubChem CID | 139255785 |
| Molecular Formula | C23H39NO3Si |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methoxy-N,4-dimethyl-3-(2-prop-1-en-2-ylphenyl)pentanamide |
| SMILES | C=C(C)c1ccccc1[C@H](CC(=O)N(C)OC)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO3Si/c1-17(2)19-13-11-12-14-20(19)21(15-22(25)24(7)26-8)18(3)16-27-28(9,10)23(4,5)6/h11-14,18,21H,1,15-16H2,2-10H3/t18-,21-/m1/s1 |
| InChIKey | LTNDFYSPFQKBDI-WIYYLYMNSA-N |
| XLogP | 5.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|