C27H37NO2 — CID 139255877
(3E,5E,7E,12Z,14E,16E,18E)-20-[(E)-hex-2-enyl]-10-hydroxy-7,16-dimethyl-1-azacycloicosa-3,5,7,12,14,16,18-heptaen-2-one (PubChem CID 139255877) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (3E,5E,7E,12Z,14E,16E,18E)-20-[(E)-hex-2-enyl]-10-hydroxy-7,16-dimethyl-1-azacycloicosa-3,5,7,12,14,16,18-heptaen-2-one.
| Compound Name | (3E,5E,7E,12Z,14E,16E,18E)-20-[(E)-hex-2-enyl]-10-hydroxy-7,16-dimethyl-1-azacycloicosa-3,5,7,12,14,16,18-heptaen-2-one |
|---|---|
| PubChem CID | 139255877 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (3E,5E,7E,12Z,14E,16E,18E)-20-[(E)-hex-2-enyl]-10-hydroxy-7,16-dimethyl-1-azacycloicosa-3,5,7,12,14,16,18-heptaen-2-one |
| SMILES | CCC/C=C/CC1/C=C/C=C(C)/C=C/C=C\CC(O)C/C=C(C)/C=C/C=C/C(=O)N1 |
| InChI | InChI=1S/C27H37NO2/c1-4-5-6-9-17-25-18-13-16-23(2)14-8-7-10-19-26(29)22-21-24(3)15-11-12-20-27(30)28-25/h6-16,18,20-21,25-26,29H,4-5,17,19,22H2,1-3H3,(H,28,30)/b9-6+,10-7-,14-8+,15-11+,18-13+,20-12+,23-16+,24-21+ |
| InChIKey | KYBFWJMEYRPLFY-XMSSNXPISA-N |
| XLogP | 6.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|