C24H19Cl3N4O8S — CID 139256054
6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole;3,5-dinitrobenzoic acid;propan-2-one (PubChem CID 139256054) has the molecular formula C24H19Cl3N4O8S and a molecular weight of 629.86 g/mol. Its IUPAC name is 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole;3,5-dinitrobenzoic acid;propan-2-one.
| Compound Name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole;3,5-dinitrobenzoic acid;propan-2-one |
|---|---|
| PubChem CID | 139256054 |
| Molecular Formula | C24H19Cl3N4O8S |
| Molecular Weight | 629.86 g/mol |
| Exact Mass | 628.00 |
| IUPAC Name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfanyl-1H-benzimidazole;3,5-dinitrobenzoic acid;propan-2-one |
| SMILES | CC(C)=O.CSc1nc2cc(Oc3cccc(Cl)c3Cl)c(Cl)cc2[nH]1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9Cl3N2OS.C7H4N2O6.C3H6O/c1-21-14-18-9-5-8(16)12(6-10(9)19-14)20-11-4-2-3-7(15)13(11)17;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;1-3(2)4/h2-6H,1H3,(H,18,19);1-3H,(H,10,11);1-2H3 |
| InChIKey | CYRKCWXXIMLWEA-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 178.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.86 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|