C23H25NS — CID 139256208
1-(4-tert-butylphenyl)-6-thiophen-2-yl-3,4-dihydro-2H-quinoline (PubChem CID 139256208) has the molecular formula C23H25NS and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-6-thiophen-2-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-tert-butylphenyl)-6-thiophen-2-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 139256208 |
| Molecular Formula | C23H25NS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-6-thiophen-2-yl-3,4-dihydro-2H-quinoline |
| SMILES | CC(C)(C)c1ccc(N2CCCc3cc(-c4cccs4)ccc32)cc1 |
| InChI | InChI=1S/C23H25NS/c1-23(2,3)19-9-11-20(12-10-19)24-14-4-6-17-16-18(8-13-21(17)24)22-7-5-15-25-22/h5,7-13,15-16H,4,6,14H2,1-3H3 |
| InChIKey | TUULYHCVGOEXOD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |