C9H8N5- — CID 139256418
6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 139256418) has the molecular formula C9H8N5- and a molecular weight of 186.20 g/mol. Its IUPAC name is 6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139256418 |
| Molecular Formula | C9H8N5- |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2[c-]cccc2)n1 |
| InChI | InChI=1S/C9H8N5/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6/h1-4H,(H4,10,11,12,13,14)/q-1 |
| InChIKey | LAMPBBUSIKSCPA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|