C22H20O3 — CID 139256471
ethyl 2-(1-phenyl-4,5-dihydrobenzo[e][1]benzofuran-2-yl)acetate (PubChem CID 139256471) has the molecular formula C22H20O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl 2-(1-phenyl-4,5-dihydrobenzo[e][1]benzofuran-2-yl)acetate.
| Compound Name | ethyl 2-(1-phenyl-4,5-dihydrobenzo[e][1]benzofuran-2-yl)acetate |
|---|---|
| PubChem CID | 139256471 |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 2-(1-phenyl-4,5-dihydrobenzo[e][1]benzofuran-2-yl)acetate |
| SMILES | CCOC(=O)Cc1oc2c(c1-c1ccccc1)-c1ccccc1CC2 |
| InChI | InChI=1S/C22H20O3/c1-2-24-20(23)14-19-21(16-9-4-3-5-10-16)22-17-11-7-6-8-15(17)12-13-18(22)25-19/h3-11H,2,12-14H2,1H3 |
| InChIKey | ANWJVOWOJJWEBE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |