C14H18O2 — CID 139256626
(1R,2R,8S)-1-methyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-7-one (PubChem CID 139256626) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1R,2R,8S)-1-methyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-7-one.
| Compound Name | (1R,2R,8S)-1-methyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-7-one |
|---|---|
| PubChem CID | 139256626 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1R,2R,8S)-1-methyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-7-one |
| SMILES | CC(C)[C@@]12C=C[C@@](C)(O1)[C@@H]1CCC=C1C2=O |
| InChI | InChI=1S/C14H18O2/c1-9(2)14-8-7-13(3,16-14)11-6-4-5-10(11)12(14)15/h5,7-9,11H,4,6H2,1-3H3/t11-,13-,14-/m1/s1 |
| InChIKey | JLEPFHBIBWEMBY-MRVWCRGKSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|