C45H47NO5S2 — CID 139256807
3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophene-1-carbaldehyde (PubChem CID 139256807) has the molecular formula C45H47NO5S2 and a molecular weight of 746.01 g/mol. Its IUPAC name is 3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophene-1-carbaldehyde.
| Compound Name | 3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophene-1-carbaldehyde |
|---|---|
| PubChem CID | 139256807 |
| Molecular Formula | C45H47NO5S2 |
| Molecular Weight | 746.01 g/mol |
| Exact Mass | 745.29 |
| IUPAC Name | 3-[7-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl]-2-benzothiophene-1-carbaldehyde |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3sc(-c4sc(C=O)c5ccccc45)c4c3OCCO4)cc2)cc1 |
| InChI | InChI=1S/C45H47NO5S2/c1-3-5-7-11-27-48-36-23-19-34(20-24-36)46(35-21-25-37(26-22-35)49-28-12-8-6-4-2)33-17-15-32(16-18-33)43-41-42(51-30-29-50-41)45(53-43)44-39-14-10-9-13-38(39)40(31-47)52-44/h9-10,13-26,31H,3-8,11-12,27-30H2,1-2H3 |
| InChIKey | GYVHXCZMXCQART-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.01 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|