About zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane
zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane (PubChem CID 139256877) has the molecular formula C14H24OSiZn
and a molecular weight of 301.82 g/mol. Its IUPAC name is zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane.
Molecular Properties
| Compound Name | zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane |
| PubChem CID | 139256877 |
| Molecular Formula | C14H24OSiZn |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc[c-]cc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C12H19OSi.C2H5.Zn/c1-12(2,3)14(4,5)13-11-9-7-6-8-10-11;1-2;/h7-10H,1-5H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | ZQTGXHMMTAOFHQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane?
The IUPAC name of zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane (CID 139256877) is zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane.
What is the SMILES notation for zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane?
The canonical SMILES for zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane is CC(C)(C)[Si](C)(C)Oc1cc[c-]cc1.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane?
The InChIKey is ZQTGXHMMTAOFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19OSi.C2H5.Zn/c1-12(2,3)14(4,5)13-11-9-7-6-8-10-11;1-2;/h7-10H,1-5H3;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane?
zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane has a molecular weight of 301.82 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;tert-butyl-dimethyl-(phenoxy)silane;ethane is sourced from PubChem (CID 139256877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).